C36H42FN5O4Si — CID 174058210
9-[(2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]-2-fluoropurin-6-amine (PubChem CID 174058210) has the molecular formula C36H42FN5O4Si and a molecular weight of 655.85 g/mol. Its IUPAC name is 9-[(2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]-2-fluoropurin-6-amine.
| Compound Name | 9-[(2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]-2-fluoropurin-6-amine |
|---|---|
| PubChem CID | 174058210 |
| Molecular Formula | C36H42FN5O4Si |
| Molecular Weight | 655.85 g/mol |
| Exact Mass | 655.30 |
| IUPAC Name | 9-[(2R,4S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]-2-fluoropurin-6-amine |
| SMILES | COc1ccc(C(OCC2O[C@@H](n3cnc4c(N)nc(F)nc43)C[C@@H]2O[Si](C)(C)C(C)(C)C)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C36H42FN5O4Si/c1-35(2,3)47(5,6)46-28-21-30(42-23-39-31-32(38)40-34(37)41-33(31)42)45-29(28)22-44-36(24-13-9-7-10-14-24,25-15-11-8-12-16-25)26-17-19-27(43-4)20-18-26/h7-20,23,28-30H,21-22H2,1-6H3,(H2,38,40,41)/t28-,29?,30+/m0/s1 |
| InChIKey | HQDGCFLVDSMSDO-YFISABEZSA-N |
| XLogP | 7.24 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.85 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|