C31H29F2N5O5 — CID 67203435
(2R,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-fluorooxolan-3-ol (PubChem CID 67203435) has the molecular formula C31H29F2N5O5 and a molecular weight of 589.60 g/mol. Its IUPAC name is (2R,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-fluorooxolan-3-ol.
| Compound Name | (2R,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-fluorooxolan-3-ol |
|---|---|
| PubChem CID | 67203435 |
| Molecular Formula | C31H29F2N5O5 |
| Molecular Weight | 589.60 g/mol |
| Exact Mass | 589.21 |
| IUPAC Name | (2R,5R)-5-(6-amino-2-fluoropurin-9-yl)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-fluorooxolan-3-ol |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(N)nc(F)nc43)C(F)C2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H29F2N5O5/c1-40-21-12-8-19(9-13-21)31(18-6-4-3-5-7-18,20-10-14-22(41-2)15-11-20)42-16-23-26(39)24(32)29(43-23)38-17-35-25-27(34)36-30(33)37-28(25)38/h3-15,17,23-24,26,29,39H,16H2,1-2H3,(H2,34,36,37)/t23-,24?,26?,29-/m1/s1 |
| InChIKey | ABLVDXCQEFSMPW-BXAZNXEPSA-N |
| XLogP | 4.17 |
| TPSA | 126.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.60 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|