C33H31N5O6 — CID 135368424
(2R,3S,4R,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-imidazo[2,1-f]purin-3-yloxolane-3,4-diol (PubChem CID 135368424) has the molecular formula C33H31N5O6 and a molecular weight of 593.64 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-imidazo[2,1-f]purin-3-yloxolane-3,4-diol.
| Compound Name | (2R,3S,4R,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-imidazo[2,1-f]purin-3-yloxolane-3,4-diol |
|---|---|
| PubChem CID | 135368424 |
| Molecular Formula | C33H31N5O6 |
| Molecular Weight | 593.64 g/mol |
| Exact Mass | 593.23 |
| IUPAC Name | (2R,3S,4R,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-imidazo[2,1-f]purin-3-yloxolane-3,4-diol |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c3ncn3ccnc43)[C@H](O)[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C33H31N5O6/c1-41-24-12-8-22(9-13-24)33(21-6-4-3-5-7-21,23-10-14-25(42-2)15-11-23)43-18-26-28(39)29(40)32(44-26)38-20-35-27-30-34-16-17-37(30)19-36-31(27)38/h3-17,19-20,26,28-29,32,39-40H,18H2,1-2H3/t26-,28-,29-,32-/m1/s1 |
| InChIKey | IMIMWQUJBGYFMP-DWCTZGTLSA-N |
| XLogP | 3.72 |
| TPSA | 125.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.64 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|