C30H30N2O7 — CID 122446943
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[[(3-methoxyphenyl)-(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]pyrimidin-2-one (PubChem CID 122446943) has the molecular formula C30H30N2O7 and a molecular weight of 530.58 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[[(3-methoxyphenyl)-(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]pyrimidin-2-one.
| Compound Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[[(3-methoxyphenyl)-(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 122446943 |
| Molecular Formula | C30H30N2O7 |
| Molecular Weight | 530.58 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[[(3-methoxyphenyl)-(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]pyrimidin-2-one |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cccnc3=O)[C@H](O)[C@@H]2O)(c2ccccc2)c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C30H30N2O7/c1-36-23-14-12-21(13-15-23)30(20-8-4-3-5-9-20,22-10-6-11-24(18-22)37-2)38-19-25-26(33)27(34)28(39-25)32-17-7-16-31-29(32)35/h3-18,25-28,33-34H,19H2,1-2H3/t25-,26-,27-,28-,30?/m1/s1 |
| InChIKey | TWCTYIOHYGVGMD-DAJQZQKASA-N |
| XLogP | 2.89 |
| TPSA | 112.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.58 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|