C37H34N2O9 — CID 23257701
1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]-3-(4-methoxybenzoyl)pyrimidine-2,4-dione (PubChem CID 23257701) has the molecular formula C37H34N2O9 and a molecular weight of 650.68 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]-3-(4-methoxybenzoyl)pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]-3-(4-methoxybenzoyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 23257701 |
| Molecular Formula | C37H34N2O9 |
| Molecular Weight | 650.68 g/mol |
| Exact Mass | 650.23 |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]-3-(4-methoxybenzoyl)pyrimidine-2,4-dione |
| SMILES | COc1ccc(C(=O)n2c(=O)ccn([C@@H]3O[C@H](COC(c4ccccc4)(c4ccccc4)c4ccc(OC)cc4)[C@@H](O)[C@H]3O)c2=O)cc1 |
| InChI | InChI=1S/C37H34N2O9/c1-45-28-17-13-24(14-18-28)34(43)39-31(40)21-22-38(36(39)44)35-33(42)32(41)30(48-35)23-47-37(25-9-5-3-6-10-25,26-11-7-4-8-12-26)27-15-19-29(46-2)20-16-27/h3-22,30,32-33,35,41-42H,23H2,1-2H3/t30-,32-,33-,35-/m1/s1 |
| InChIKey | LMDFPHSECBECCC-NHASGABXSA-N |
| XLogP | 3.34 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.68 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|