C38H46N6O8Si — CID 151979938
2-trimethylsilylethyl N-[[6-amino-9-[(2R,3R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3,4-dihydroxyoxolan-2-yl]purin-2-yl]methyl]carbamate (PubChem CID 151979938) has the molecular formula C38H46N6O8Si and a molecular weight of 742.91 g/mol. Its IUPAC name is 2-trimethylsilylethyl N-[[6-amino-9-[(2R,3R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3,4-dihydroxyoxolan-2-yl]purin-2-yl]methyl]carbamate.
| Compound Name | 2-trimethylsilylethyl N-[[6-amino-9-[(2R,3R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3,4-dihydroxyoxolan-2-yl]purin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 151979938 |
| Molecular Formula | C38H46N6O8Si |
| Molecular Weight | 742.91 g/mol |
| Exact Mass | 742.31 |
| IUPAC Name | 2-trimethylsilylethyl N-[[6-amino-9-[(2R,3R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3,4-dihydroxyoxolan-2-yl]purin-2-yl]methyl]carbamate |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc4c(N)nc(CNC(=O)OCC[Si](C)(C)C)nc43)[C@H](O)[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C38H46N6O8Si/c1-48-27-15-11-25(12-16-27)38(24-9-7-6-8-10-24,26-13-17-28(49-2)18-14-26)51-22-29-32(45)33(46)36(52-29)44-23-41-31-34(39)42-30(43-35(31)44)21-40-37(47)50-19-20-53(3,4)5/h6-18,23,29,32-33,36,45-46H,19-22H2,1-5H3,(H,40,47)(H2,39,42,43)/t29-,32-,33-,36-/m1/s1 |
| InChIKey | UCLQPTDKRPUYRS-JRFMUSTFSA-N |
| XLogP | 4.62 |
| TPSA | 185.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.91 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|