C30H29N5O5 — CID 135753569
2-amino-9-[(2R,3R,4S)-3-hydroxy-4-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]-1H-purin-6-one (PubChem CID 135753569) has the molecular formula C30H29N5O5 and a molecular weight of 539.59 g/mol. Its IUPAC name is 2-amino-9-[(2R,3R,4S)-3-hydroxy-4-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[(2R,3R,4S)-3-hydroxy-4-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 135753569 |
| Molecular Formula | C30H29N5O5 |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.22 |
| IUPAC Name | 2-amino-9-[(2R,3R,4S)-3-hydroxy-4-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]oxolan-2-yl]-1H-purin-6-one |
| SMILES | COc1ccc(C(OC[C@H]2CO[C@@H](n3cnc4c(=O)[nH]c(N)nc43)[C@@H]2O)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H29N5O5/c1-38-23-14-12-22(13-15-23)30(20-8-4-2-5-9-20,21-10-6-3-7-11-21)40-17-19-16-39-28(25(19)36)35-18-32-24-26(35)33-29(31)34-27(24)37/h2-15,18-19,25,28,36H,16-17H2,1H3,(H3,31,33,34,37)/t19-,25-,28-/m1/s1 |
| InChIKey | AGUQMQBONNUECJ-UUPLDMHLSA-N |
| XLogP | 3.22 |
| TPSA | 137.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|