C26H27FO6 — CID 171124942
(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-fluorooxolane-2,4-diol (PubChem CID 171124942) has the molecular formula C26H27FO6 and a molecular weight of 454.49 g/mol. Its IUPAC name is (2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-fluorooxolane-2,4-diol.
| Compound Name | (2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-fluorooxolane-2,4-diol |
|---|---|
| PubChem CID | 171124942 |
| Molecular Formula | C26H27FO6 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.18 |
| IUPAC Name | (2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-3-fluorooxolane-2,4-diol |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](O)[C@H](F)[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C26H27FO6/c1-30-20-12-8-18(9-13-20)26(17-6-4-3-5-7-17,19-10-14-21(31-2)15-11-19)32-16-22-24(28)23(27)25(29)33-22/h3-15,22-25,28-29H,16H2,1-2H3/t22-,23-,24-,25-/m1/s1 |
| InChIKey | YJGNRBCEEWWVFM-ZGFBMJKBSA-N |
| XLogP | 3.43 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|