C33H32O7 — CID 11478258
(2R,3aR,4S,6R,6aR)-2-(4-methoxyphenyl)-6-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-ol (PubChem CID 11478258) has the molecular formula C33H32O7 and a molecular weight of 540.61 g/mol. Its IUPAC name is (2R,3aR,4S,6R,6aR)-2-(4-methoxyphenyl)-6-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-ol.
| Compound Name | (2R,3aR,4S,6R,6aR)-2-(4-methoxyphenyl)-6-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-ol |
|---|---|
| PubChem CID | 11478258 |
| Molecular Formula | C33H32O7 |
| Molecular Weight | 540.61 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | (2R,3aR,4S,6R,6aR)-2-(4-methoxyphenyl)-6-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-ol |
| SMILES | COc1ccc([C@H]2O[C@@H]3[C@H](O2)[C@@H](COC(c2ccccc2)(c2ccccc2)c2ccc(OC)cc2)O[C@@H]3O)cc1 |
| InChI | InChI=1S/C33H32O7/c1-35-26-17-13-22(14-18-26)32-39-29-28(38-31(34)30(29)40-32)21-37-33(23-9-5-3-6-10-23,24-11-7-4-8-12-24)25-15-19-27(36-2)20-16-25/h3-20,28-32,34H,21H2,1-2H3/t28-,29-,30-,31+,32-/m1/s1 |
| InChIKey | IGZYHFYGVSEZAV-QDAPXQGYSA-N |
| XLogP | 5.21 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.61 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|