C25H24O4 — CID 22849380
(1R,2R,5R)-2-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-3,6-dioxabicyclo[3.1.0]hexane (PubChem CID 22849380) has the molecular formula C25H24O4 and a molecular weight of 388.46 g/mol. Its IUPAC name is (1R,2R,5R)-2-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-3,6-dioxabicyclo[3.1.0]hexane.
| Compound Name | (1R,2R,5R)-2-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-3,6-dioxabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 22849380 |
| Molecular Formula | C25H24O4 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | (1R,2R,5R)-2-[[(4-methoxyphenyl)-diphenylmethoxy]methyl]-3,6-dioxabicyclo[3.1.0]hexane |
| SMILES | COc1ccc(C(OC[C@H]2OC[C@H]3O[C@@H]23)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H24O4/c1-26-21-14-12-20(13-15-21)25(18-8-4-2-5-9-18,19-10-6-3-7-11-19)28-17-22-24-23(29-24)16-27-22/h2-15,22-24H,16-17H2,1H3/t22-,23-,24+/m1/s1 |
| InChIKey | UWPIRQGTULSQSD-SMIHKQSGSA-N |
| XLogP | 4.17 |
| TPSA | 40.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|