C26H27FO4 — CID 68719586
(2R,3R)-3-fluoro-2-[[(3-methoxyphenyl)-(4-methoxyphenyl)-phenylmethoxy]methyl]oxolane (PubChem CID 68719586) has the molecular formula C26H27FO4 and a molecular weight of 422.50 g/mol. Its IUPAC name is (2R,3R)-3-fluoro-2-[[(3-methoxyphenyl)-(4-methoxyphenyl)-phenylmethoxy]methyl]oxolane.
| Compound Name | (2R,3R)-3-fluoro-2-[[(3-methoxyphenyl)-(4-methoxyphenyl)-phenylmethoxy]methyl]oxolane |
|---|---|
| PubChem CID | 68719586 |
| Molecular Formula | C26H27FO4 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | (2R,3R)-3-fluoro-2-[[(3-methoxyphenyl)-(4-methoxyphenyl)-phenylmethoxy]methyl]oxolane |
| SMILES | COc1ccc(C(OC[C@H]2OCC[C@H]2F)(c2ccccc2)c2cccc(OC)c2)cc1 |
| InChI | InChI=1S/C26H27FO4/c1-28-22-13-11-20(12-14-22)26(19-7-4-3-5-8-19,21-9-6-10-23(17-21)29-2)31-18-25-24(27)15-16-30-25/h3-14,17,24-25H,15-16,18H2,1-2H3/t24-,25-,26?/m1/s1 |
| InChIKey | LVMWYMGPSYAEFK-YFHSQZFMSA-N |
| XLogP | 5.14 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|