C31H31NO5 — CID 46919604
(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-pyridin-2-yloxolan-3-ol (PubChem CID 46919604) has the molecular formula C31H31NO5 and a molecular weight of 497.59 g/mol. Its IUPAC name is (2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-pyridin-2-yloxolan-3-ol.
| Compound Name | (2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-pyridin-2-yloxolan-3-ol |
|---|---|
| PubChem CID | 46919604 |
| Molecular Formula | C31H31NO5 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.22 |
| IUPAC Name | (2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-pyridin-2-yloxolan-3-ol |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](c3ccccn3)C[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H31NO5/c1-34-25-15-11-23(12-16-25)31(22-8-4-3-5-9-22,24-13-17-26(35-2)18-14-24)36-21-30-28(33)20-29(37-30)27-10-6-7-19-32-27/h3-19,28-30,33H,20-21H2,1-2H3/t28-,29+,30+/m0/s1 |
| InChIKey | IWTJBTHXWLFFDH-FRXPANAUSA-N |
| XLogP | 5.30 |
| TPSA | 70.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|