C31H34N4O5 — CID 169087815
(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(2,3,7,8-tetrahydropurin-9-yl)oxolan-3-ol (PubChem CID 169087815) has the molecular formula C31H34N4O5 and a molecular weight of 542.64 g/mol. Its IUPAC name is (2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(2,3,7,8-tetrahydropurin-9-yl)oxolan-3-ol.
| Compound Name | (2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(2,3,7,8-tetrahydropurin-9-yl)oxolan-3-ol |
|---|---|
| PubChem CID | 169087815 |
| Molecular Formula | C31H34N4O5 |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | (2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(2,3,7,8-tetrahydropurin-9-yl)oxolan-3-ol |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](N3CNC4=C3NCN=C4)C[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H34N4O5/c1-37-24-12-8-22(9-13-24)31(21-6-4-3-5-7-21,23-10-14-25(38-2)15-11-23)39-18-28-27(36)16-29(40-28)35-20-34-26-17-32-19-33-30(26)35/h3-15,17,27-29,33-34,36H,16,18-20H2,1-2H3/t27-,28+,29+/m0/s1 |
| InChIKey | VQDYWNQCSAQAIZ-ZGIBFIJWSA-N |
| XLogP | 3.15 |
| TPSA | 96.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|