C30H33NO6 — CID 90169008
(2R,3R,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(2,6-dihydro-1,3-oxazin-3-yl)oxolan-3-ol (PubChem CID 90169008) has the molecular formula C30H33NO6 and a molecular weight of 503.60 g/mol. Its IUPAC name is (2R,3R,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(2,6-dihydro-1,3-oxazin-3-yl)oxolan-3-ol.
| Compound Name | (2R,3R,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(2,6-dihydro-1,3-oxazin-3-yl)oxolan-3-ol |
|---|---|
| PubChem CID | 90169008 |
| Molecular Formula | C30H33NO6 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.23 |
| IUPAC Name | (2R,3R,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(2,6-dihydro-1,3-oxazin-3-yl)oxolan-3-ol |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](N3C=CCOC3)C[C@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C30H33NO6/c1-33-25-13-9-23(10-14-25)30(22-7-4-3-5-8-22,24-11-15-26(34-2)16-12-24)36-20-28-27(32)19-29(37-28)31-17-6-18-35-21-31/h3-17,27-29,32H,18-21H2,1-2H3/t27-,28-,29-/m1/s1 |
| InChIKey | PJGDOXFWPYJOHL-MPFGFTFXSA-N |
| XLogP | 4.29 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|