C29H29IN2O5 — CID 24773384
(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(4-iodoimidazol-1-yl)oxolan-3-ol (PubChem CID 24773384) has the molecular formula C29H29IN2O5 and a molecular weight of 612.46 g/mol. Its IUPAC name is (2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(4-iodoimidazol-1-yl)oxolan-3-ol.
| Compound Name | (2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(4-iodoimidazol-1-yl)oxolan-3-ol |
|---|---|
| PubChem CID | 24773384 |
| Molecular Formula | C29H29IN2O5 |
| Molecular Weight | 612.46 g/mol |
| Exact Mass | 612.11 |
| IUPAC Name | (2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(4-iodoimidazol-1-yl)oxolan-3-ol |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc(I)c3)C[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C29H29IN2O5/c1-34-23-12-8-21(9-13-23)29(20-6-4-3-5-7-20,22-10-14-24(35-2)15-11-22)36-18-26-25(33)16-28(37-26)32-17-27(30)31-19-32/h3-15,17,19,25-26,28,33H,16,18H2,1-2H3/t25-,26+,28+/m0/s1 |
| InChIKey | RPPGYPUPIFTOJR-ZRRKCSAHSA-N |
| XLogP | 5.16 |
| TPSA | 74.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.46 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|