C32H35N5O6 — CID 138958110
N'-[5-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-4-oxo-1,3,5-triazin-2-yl]-N,N-dimethylmethanimidamide (PubChem CID 138958110) has the molecular formula C32H35N5O6 and a molecular weight of 585.66 g/mol. Its IUPAC name is N'-[5-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-4-oxo-1,3,5-triazin-2-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[5-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-4-oxo-1,3,5-triazin-2-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 138958110 |
| Molecular Formula | C32H35N5O6 |
| Molecular Weight | 585.66 g/mol |
| Exact Mass | 585.26 |
| IUPAC Name | N'-[5-[(2R,4S,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxyoxolan-2-yl]-4-oxo-1,3,5-triazin-2-yl]-N,N-dimethylmethanimidamide |
| SMILES | COc1ccc(C(OC[C@H]2O[C@@H](n3cnc(/N=C/N(C)C)nc3=O)C[C@@H]2O)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H35N5O6/c1-36(2)20-33-30-34-21-37(31(39)35-30)29-18-27(38)28(43-29)19-42-32(22-8-6-5-7-9-22,23-10-14-25(40-3)15-11-23)24-12-16-26(41-4)17-13-24/h5-17,20-21,27-29,38H,18-19H2,1-4H3/b33-20+/t27-,28+,29+/m0/s1 |
| InChIKey | YOXHYNUWWTXEDF-HTEJUNIZSA-N |
| XLogP | 3.53 |
| TPSA | 120.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.66 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|