C12H19N5O3 — CID 164960281
N'-[5-(5-ethyl-4-hydroxyoxolan-2-yl)-4-oxo-1,3,5-triazin-2-yl]-N,N-dimethylmethanimidamide (PubChem CID 164960281) has the molecular formula C12H19N5O3 and a molecular weight of 281.32 g/mol. Its IUPAC name is N'-[5-(5-ethyl-4-hydroxyoxolan-2-yl)-4-oxo-1,3,5-triazin-2-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[5-(5-ethyl-4-hydroxyoxolan-2-yl)-4-oxo-1,3,5-triazin-2-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 164960281 |
| Molecular Formula | C12H19N5O3 |
| Molecular Weight | 281.32 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | N'-[5-(5-ethyl-4-hydroxyoxolan-2-yl)-4-oxo-1,3,5-triazin-2-yl]-N,N-dimethylmethanimidamide |
| SMILES | CCC1OC(n2cnc(N=CN(C)C)nc2=O)CC1O |
| InChI | InChI=1S/C12H19N5O3/c1-4-9-8(18)5-10(20-9)17-7-14-11(15-12(17)19)13-6-16(2)3/h6-10,18H,4-5H2,1-3H3 |
| InChIKey | WHPHCTKIFZCHJK-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 92.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.32 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|