C14H21ClN6O2 — CID 158305345
N'-[6-chloro-9-(5-ethyl-4-hydroxyoxolan-2-yl)-3,6-dihydropurin-2-yl]-N,N-dimethylmethanimidamide (PubChem CID 158305345) has the molecular formula C14H21ClN6O2 and a molecular weight of 340.82 g/mol. Its IUPAC name is N'-[6-chloro-9-(5-ethyl-4-hydroxyoxolan-2-yl)-3,6-dihydropurin-2-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[6-chloro-9-(5-ethyl-4-hydroxyoxolan-2-yl)-3,6-dihydropurin-2-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 158305345 |
| Molecular Formula | C14H21ClN6O2 |
| Molecular Weight | 340.82 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | N'-[6-chloro-9-(5-ethyl-4-hydroxyoxolan-2-yl)-3,6-dihydropurin-2-yl]-N,N-dimethylmethanimidamide |
| SMILES | CCC1OC(n2cnc3c2NC(N=CN(C)C)=NC3Cl)CC1O |
| InChI | InChI=1S/C14H21ClN6O2/c1-4-9-8(22)5-10(23-9)21-7-16-11-12(15)18-14(19-13(11)21)17-6-20(2)3/h6-10,12,22H,4-5H2,1-3H3,(H,18,19) |
| InChIKey | NJKBSHHKICTFMA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 87.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.82 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|