C13H24N2O3 — CID 176926407
ethane;5-(4-ethyl-5-methylimidazol-1-yl)-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 176926407) has the molecular formula C13H24N2O3 and a molecular weight of 256.35 g/mol. Its IUPAC name is ethane;5-(4-ethyl-5-methylimidazol-1-yl)-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | ethane;5-(4-ethyl-5-methylimidazol-1-yl)-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 176926407 |
| Molecular Formula | C13H24N2O3 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | ethane;5-(4-ethyl-5-methylimidazol-1-yl)-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | CC.CCc1ncn(C2CC(O)C(CO)O2)c1C |
| InChI | InChI=1S/C11H18N2O3.C2H6/c1-3-8-7(2)13(6-12-8)11-4-9(15)10(5-14)16-11;1-2/h6,9-11,14-15H,3-5H2,1-2H3;1-2H3 |
| InChIKey | IOYSPGLTUPFVJQ-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |