C14H23N5O4S2 — CID 146424765
2-amino-6-(butan-2-yldisulfanyl)-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-ol (PubChem CID 146424765) has the molecular formula C14H23N5O4S2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 2-amino-6-(butan-2-yldisulfanyl)-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-ol.
| Compound Name | 2-amino-6-(butan-2-yldisulfanyl)-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-ol |
|---|---|
| PubChem CID | 146424765 |
| Molecular Formula | C14H23N5O4S2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.12 |
| IUPAC Name | 2-amino-6-(butan-2-yldisulfanyl)-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-ol |
| SMILES | CCC(C)SSC1(O)N=C(N)Nc2c1ncn2[C@H]1C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C14H23N5O4S2/c1-3-7(2)24-25-14(22)11-12(17-13(15)18-14)19(6-16-11)10-4-8(21)9(5-20)23-10/h6-10,20-22H,3-5H2,1-2H3,(H3,15,17,18)/t7?,8-,9+,10+,14?/m0/s1 |
| InChIKey | LYDBSHBAZYJZJU-XUEJEWSRSA-N |
| XLogP | 0.55 |
| TPSA | 138.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|