C10H16N6O4 — CID 140514792
2,6-diamino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-ol (PubChem CID 140514792) has the molecular formula C10H16N6O4 and a molecular weight of 284.28 g/mol. Its IUPAC name is 2,6-diamino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-ol.
| Compound Name | 2,6-diamino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-ol |
|---|---|
| PubChem CID | 140514792 |
| Molecular Formula | C10H16N6O4 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 2,6-diamino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-3H-purin-6-ol |
| SMILES | NC1=NC(N)(O)c2ncn([C@H]3C[C@H](O)[C@@H](CO)O3)c2N1 |
| InChI | InChI=1S/C10H16N6O4/c11-9-14-8-7(10(12,19)15-9)13-3-16(8)6-1-4(18)5(2-17)20-6/h3-6,17-19H,1-2,12H2,(H3,11,14,15)/t4-,5+,6+,10?/m0/s1 |
| InChIKey | QFQZJKWGCWRTGZ-JKGXRCIZSA-N |
| XLogP | -2.67 |
| TPSA | 164.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | -2.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|