C15H27N5O4Si — CID 149159415
2-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(2-trimethylsilylethyl)-3H-purin-6-ol (PubChem CID 149159415) has the molecular formula C15H27N5O4Si and a molecular weight of 369.50 g/mol. Its IUPAC name is 2-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(2-trimethylsilylethyl)-3H-purin-6-ol.
| Compound Name | 2-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(2-trimethylsilylethyl)-3H-purin-6-ol |
|---|---|
| PubChem CID | 149159415 |
| Molecular Formula | C15H27N5O4Si |
| Molecular Weight | 369.50 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 2-amino-9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-(2-trimethylsilylethyl)-3H-purin-6-ol |
| SMILES | C[Si](C)(C)CCC1(O)N=C(N)Nc2c1ncn2[C@H]1C[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C15H27N5O4Si/c1-25(2,3)5-4-15(23)12-13(18-14(16)19-15)20(8-17-12)11-6-9(22)10(7-21)24-11/h8-11,21-23H,4-7H2,1-3H3,(H3,16,18,19)/t9-,10+,11+,15?/m0/s1 |
| InChIKey | YOGYANCHEBZPMZ-DZHKABLVSA-N |
| XLogP | 0.14 |
| TPSA | 138.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.50 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|