C19H32N6O4Si — CID 177465625
N'-[9-[(2S,4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide (PubChem CID 177465625) has the molecular formula C19H32N6O4Si and a molecular weight of 436.59 g/mol. Its IUPAC name is N'-[9-[(2S,4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[9-[(2S,4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 177465625 |
| Molecular Formula | C19H32N6O4Si |
| Molecular Weight | 436.59 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | N'-[9-[(2S,4S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-hydroxyoxolan-2-yl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide |
| SMILES | CN(C)/C=N/c1nc2c(ncn2[C@@H]2C[C@H](O)[C@H](CO[Si](C)(C)C(C)(C)C)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C19H32N6O4Si/c1-19(2,3)30(6,7)28-9-13-12(26)8-14(29-13)25-11-20-15-16(25)22-18(23-17(15)27)21-10-24(4)5/h10-14,26H,8-9H2,1-7H3,(H,22,23,27)/b21-10+/t12-,13-,14-/m0/s1 |
| InChIKey | NDWNAZWXXXGPBU-CLWQLUMFSA-N |
| XLogP | 2.01 |
| TPSA | 117.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.59 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|