C12H17N5O4 — CID 155898483
2-(dimethylamino)-9-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one (PubChem CID 155898483) has the molecular formula C12H17N5O4 and a molecular weight of 295.30 g/mol. Its IUPAC name is 2-(dimethylamino)-9-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one.
| Compound Name | 2-(dimethylamino)-9-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 155898483 |
| Molecular Formula | C12H17N5O4 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.13 |
| IUPAC Name | 2-(dimethylamino)-9-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-1H-purin-6-one |
| SMILES | CN(C)c1nc2c(ncn2C2CC(O)C(CO)O2)c(=O)[nH]1 |
| InChI | InChI=1S/C12H17N5O4/c1-16(2)12-14-10-9(11(20)15-12)13-5-17(10)8-3-6(19)7(4-18)21-8/h5-8,18-19H,3-4H2,1-2H3,(H,14,15,20) |
| InChIKey | IKDIHBAQIZQROC-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 116.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |