C24H41N7O5Si — CID 162458998
N'-[9-[(2R,3S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-5-(morpholin-4-ylmethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide (PubChem CID 162458998) has the molecular formula C24H41N7O5Si and a molecular weight of 535.72 g/mol. Its IUPAC name is N'-[9-[(2R,3S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-5-(morpholin-4-ylmethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[9-[(2R,3S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-5-(morpholin-4-ylmethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 162458998 |
| Molecular Formula | C24H41N7O5Si |
| Molecular Weight | 535.72 g/mol |
| Exact Mass | 535.29 |
| IUPAC Name | N'-[9-[(2R,3S,5R)-4-[tert-butyl(dimethyl)silyl]oxy-3-methoxy-5-(morpholin-4-ylmethyl)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide |
| SMILES | CO[C@H]1C(O[Si](C)(C)C(C)(C)C)[C@@H](CN2CCOCC2)O[C@H]1n1cnc2c(=O)[nH]c(/N=C/N(C)C)nc21 |
| InChI | InChI=1S/C24H41N7O5Si/c1-24(2,3)37(7,8)36-18-16(13-30-9-11-34-12-10-30)35-22(19(18)33-6)31-15-25-17-20(31)27-23(28-21(17)32)26-14-29(4)5/h14-16,18-19,22H,9-13H2,1-8H3,(H,27,28,32)/b26-14+/t16-,18?,19+,22-/m1/s1 |
| InChIKey | IPSFQPIILMQJFT-JQWLJWEUSA-N |
| XLogP | 1.98 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.72 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|