C21H36N6O4SSi — CID 153455770
N'-[9-[(2R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(methylsulfanylmethoxy)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide (PubChem CID 153455770) has the molecular formula C21H36N6O4SSi and a molecular weight of 496.71 g/mol. Its IUPAC name is N'-[9-[(2R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(methylsulfanylmethoxy)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[9-[(2R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(methylsulfanylmethoxy)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 153455770 |
| Molecular Formula | C21H36N6O4SSi |
| Molecular Weight | 496.71 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | N'-[9-[(2R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(methylsulfanylmethoxy)oxolan-2-yl]-6-oxo-1H-purin-2-yl]-N,N-dimethylmethanimidamide |
| SMILES | CSCO[C@@H]1C[C@H](n2cnc3c(=O)[nH]c(/N=C\N(C)C)nc32)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H36N6O4SSi/c1-21(2,3)33(7,8)30-10-15-14(29-13-32-6)9-16(31-15)27-12-22-17-18(27)24-20(25-19(17)28)23-11-26(4)5/h11-12,14-16H,9-10,13H2,1-8H3,(H,24,25,28)/b23-11-/t14-,15-,16-/m1/s1 |
| InChIKey | CKAUNTURMNKFMJ-GMDKWOSJSA-N |
| XLogP | 3.36 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.71 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|