C19H33IN4O4SSi — CID 140914242
N'-[1-[(2R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylsulfanyloxyoxolan-2-yl]-5-iodo-2-oxopyrimidin-4-yl]-N,N-dimethylmethanimidamide (PubChem CID 140914242) has the molecular formula C19H33IN4O4SSi and a molecular weight of 568.55 g/mol. Its IUPAC name is N'-[1-[(2R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylsulfanyloxyoxolan-2-yl]-5-iodo-2-oxopyrimidin-4-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[1-[(2R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylsulfanyloxyoxolan-2-yl]-5-iodo-2-oxopyrimidin-4-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 140914242 |
| Molecular Formula | C19H33IN4O4SSi |
| Molecular Weight | 568.55 g/mol |
| Exact Mass | 568.10 |
| IUPAC Name | N'-[1-[(2R,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-methylsulfanyloxyoxolan-2-yl]-5-iodo-2-oxopyrimidin-4-yl]-N,N-dimethylmethanimidamide |
| SMILES | CSO[C@@H]1C[C@H](n2cc(I)c(/N=C/N(C)C)nc2=O)O[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H33IN4O4SSi/c1-19(2,3)30(7,8)26-11-15-14(28-29-6)9-16(27-15)24-10-13(20)17(22-18(24)25)21-12-23(4)5/h10,12,14-16H,9,11H2,1-8H3/b21-12+/t14-,15-,16-/m1/s1 |
| InChIKey | PCJMYGLLGKBTQU-MPWDILAASA-N |
| XLogP | 4.04 |
| TPSA | 78.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|