C32H40IN5O3Si — CID 158676946
N'-[7-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-ethoxyoxolan-2-yl]-5-iodopyrrolo[2,3-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide (PubChem CID 158676946) has the molecular formula C32H40IN5O3Si and a molecular weight of 697.69 g/mol. Its IUPAC name is N'-[7-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-ethoxyoxolan-2-yl]-5-iodopyrrolo[2,3-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[7-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-ethoxyoxolan-2-yl]-5-iodopyrrolo[2,3-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 158676946 |
| Molecular Formula | C32H40IN5O3Si |
| Molecular Weight | 697.69 g/mol |
| Exact Mass | 697.19 |
| IUPAC Name | N'-[7-[(2R,5R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-ethoxyoxolan-2-yl]-5-iodopyrrolo[2,3-d]pyrimidin-4-yl]-N,N-dimethylmethanimidamide |
| SMILES | CCOC1C[C@H](n2cc(I)c3c(N=CN(C)C)ncnc32)O[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H40IN5O3Si/c1-7-39-26-18-28(38-19-25(33)29-30(36-22-37(5)6)34-21-35-31(29)38)41-27(26)20-40-42(32(2,3)4,23-14-10-8-11-15-23)24-16-12-9-13-17-24/h8-17,19,21-22,26-28H,7,18,20H2,1-6H3/t26?,27-,28-/m1/s1 |
| InChIKey | XROLXQQLXJJTPI-DXISBFFWSA-N |
| XLogP | 5.53 |
| TPSA | 74.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.69 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|