C33H40N6O6Si — CID 11017692
[(2R,3R,4R,5R)-4-acetyloxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[6-[(E)-dimethylaminomethylideneamino]purin-9-yl]oxolan-3-yl] acetate (PubChem CID 11017692) has the molecular formula C33H40N6O6Si and a molecular weight of 644.81 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-4-acetyloxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[6-[(E)-dimethylaminomethylideneamino]purin-9-yl]oxolan-3-yl] acetate.
| Compound Name | [(2R,3R,4R,5R)-4-acetyloxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[6-[(E)-dimethylaminomethylideneamino]purin-9-yl]oxolan-3-yl] acetate |
|---|---|
| PubChem CID | 11017692 |
| Molecular Formula | C33H40N6O6Si |
| Molecular Weight | 644.81 g/mol |
| Exact Mass | 644.28 |
| IUPAC Name | [(2R,3R,4R,5R)-4-acetyloxy-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-5-[6-[(E)-dimethylaminomethylideneamino]purin-9-yl]oxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@H]1n1cnc2c(/N=C/N(C)C)ncnc21 |
| InChI | InChI=1S/C33H40N6O6Si/c1-22(40)43-28-26(18-42-46(33(3,4)5,24-14-10-8-11-15-24)25-16-12-9-13-17-25)45-32(29(28)44-23(2)41)39-21-36-27-30(37-20-38(6)7)34-19-35-31(27)39/h8-17,19-21,26,28-29,32H,18H2,1-7H3/b37-20+/t26-,28-,29-,32-/m1/s1 |
| InChIKey | PFEOIVCCVZPOIG-ZKNFFRRDSA-N |
| XLogP | 3.39 |
| TPSA | 130.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.81 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|