C32H40N6O3S2Si — CID 174104356
N'-[9-[(2R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(1R)-1-(methyldisulfanyl)ethoxy]-2,3-dihydrofuran-2-yl]purin-6-yl]-N,N-dimethylmethanimidamide (PubChem CID 174104356) has the molecular formula C32H40N6O3S2Si and a molecular weight of 648.93 g/mol. Its IUPAC name is N'-[9-[(2R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(1R)-1-(methyldisulfanyl)ethoxy]-2,3-dihydrofuran-2-yl]purin-6-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[9-[(2R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(1R)-1-(methyldisulfanyl)ethoxy]-2,3-dihydrofuran-2-yl]purin-6-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 174104356 |
| Molecular Formula | C32H40N6O3S2Si |
| Molecular Weight | 648.93 g/mol |
| Exact Mass | 648.24 |
| IUPAC Name | N'-[9-[(2R)-5-[[tert-butyl(diphenyl)silyl]oxymethyl]-4-[(1R)-1-(methyldisulfanyl)ethoxy]-2,3-dihydrofuran-2-yl]purin-6-yl]-N,N-dimethylmethanimidamide |
| SMILES | CSS[C@H](C)OC1=C(CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)O[C@@H](n2cnc3c(N=CN(C)C)ncnc32)C1 |
| InChI | InChI=1S/C32H40N6O3S2Si/c1-23(43-42-7)40-26-18-28(38-22-35-29-30(36-21-37(5)6)33-20-34-31(29)38)41-27(26)19-39-44(32(2,3)4,24-14-10-8-11-15-24)25-16-12-9-13-17-25/h8-17,20-23,28H,18-19H2,1-7H3/t23-,28-/m1/s1 |
| InChIKey | MUMHJJDAQLHNMO-QDPGVEIFSA-N |
| XLogP | 6.13 |
| TPSA | 86.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.93 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|