C16H24N6O3S2 — CID 154619250
N'-[9-[(2R,5R)-5-(hydroxymethyl)-4-[(1S)-1-(methyldisulfanyl)ethoxy]oxolan-2-yl]purin-6-yl]-N,N-dimethylmethanimidamide (PubChem CID 154619250) has the molecular formula C16H24N6O3S2 and a molecular weight of 412.54 g/mol. Its IUPAC name is N'-[9-[(2R,5R)-5-(hydroxymethyl)-4-[(1S)-1-(methyldisulfanyl)ethoxy]oxolan-2-yl]purin-6-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[9-[(2R,5R)-5-(hydroxymethyl)-4-[(1S)-1-(methyldisulfanyl)ethoxy]oxolan-2-yl]purin-6-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 154619250 |
| Molecular Formula | C16H24N6O3S2 |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | N'-[9-[(2R,5R)-5-(hydroxymethyl)-4-[(1S)-1-(methyldisulfanyl)ethoxy]oxolan-2-yl]purin-6-yl]-N,N-dimethylmethanimidamide |
| SMILES | CSS[C@@H](C)OC1C[C@H](n2cnc3c(/N=C/N(C)C)ncnc32)O[C@@H]1CO |
| InChI | InChI=1S/C16H24N6O3S2/c1-10(27-26-4)24-11-5-13(25-12(11)6-23)22-9-19-14-15(20-8-21(2)3)17-7-18-16(14)22/h7-13,23H,5-6H2,1-4H3/b20-8+/t10-,11?,12+,13+/m0/s1 |
| InChIKey | IJIQJSFVOCQDIZ-JOHBBKGUSA-N |
| XLogP | 2.07 |
| TPSA | 97.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|