C15H22N6O2 — CID 58492830
N'-[9-[(1R,3S,4S)-4-ethyl-2,3-dihydroxycyclopentyl]purin-6-yl]-N,N-dimethylmethanimidamide (PubChem CID 58492830) has the molecular formula C15H22N6O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is N'-[9-[(1R,3S,4S)-4-ethyl-2,3-dihydroxycyclopentyl]purin-6-yl]-N,N-dimethylmethanimidamide.
| Compound Name | N'-[9-[(1R,3S,4S)-4-ethyl-2,3-dihydroxycyclopentyl]purin-6-yl]-N,N-dimethylmethanimidamide |
|---|---|
| PubChem CID | 58492830 |
| Molecular Formula | C15H22N6O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | N'-[9-[(1R,3S,4S)-4-ethyl-2,3-dihydroxycyclopentyl]purin-6-yl]-N,N-dimethylmethanimidamide |
| SMILES | CC[C@H]1C[C@@H](n2cnc3c(/N=C/N(C)C)ncnc32)C(O)[C@H]1O |
| InChI | InChI=1S/C15H22N6O2/c1-4-9-5-10(13(23)12(9)22)21-8-18-11-14(19-7-20(2)3)16-6-17-15(11)21/h6-10,12-13,22-23H,4-5H2,1-3H3/b19-7+/t9-,10+,12-,13?/m0/s1 |
| InChIKey | LIGZNFFMMXVXSN-IIBVYPORSA-N |
| XLogP | 0.74 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|