C14H21N5O3 — CID 10566661
(1R,2R,3R,5R)-3-[6-(dimethylamino)purin-9-yl]cycloheptane-1,2,5-triol (PubChem CID 10566661) has the molecular formula C14H21N5O3 and a molecular weight of 307.35 g/mol. Its IUPAC name is (1R,2R,3R,5R)-3-[6-(dimethylamino)purin-9-yl]cycloheptane-1,2,5-triol.
| Compound Name | (1R,2R,3R,5R)-3-[6-(dimethylamino)purin-9-yl]cycloheptane-1,2,5-triol |
|---|---|
| PubChem CID | 10566661 |
| Molecular Formula | C14H21N5O3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | (1R,2R,3R,5R)-3-[6-(dimethylamino)purin-9-yl]cycloheptane-1,2,5-triol |
| SMILES | CN(C)c1ncnc2c1ncn2[C@@H]1C[C@H](O)CC[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H21N5O3/c1-18(2)13-11-14(16-6-15-13)19(7-17-11)9-5-8(20)3-4-10(21)12(9)22/h6-10,12,20-22H,3-5H2,1-2H3/t8-,9-,10-,12-/m1/s1 |
| InChIKey | CRJDBHROTWOEEH-DNRKLUKYSA-N |
| XLogP | -0.30 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |