C13H17N5 — CID 124606574
9-[(1R)-cyclohex-2-en-1-yl]-N,N-dimethylpurin-6-amine (PubChem CID 124606574) has the molecular formula C13H17N5 and a molecular weight of 243.31 g/mol. Its IUPAC name is 9-[(1R)-cyclohex-2-en-1-yl]-N,N-dimethylpurin-6-amine.
| Compound Name | 9-[(1R)-cyclohex-2-en-1-yl]-N,N-dimethylpurin-6-amine |
|---|---|
| PubChem CID | 124606574 |
| Molecular Formula | C13H17N5 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | 9-[(1R)-cyclohex-2-en-1-yl]-N,N-dimethylpurin-6-amine |
| SMILES | CN(C)c1ncnc2c1ncn2[C@H]1C=CCCC1 |
| InChI | InChI=1S/C13H17N5/c1-17(2)12-11-13(15-8-14-12)18(9-16-11)10-6-4-3-5-7-10/h4,6,8-10H,3,5,7H2,1-2H3/t10-/m0/s1 |
| InChIKey | MRUNKAJRAGSRMG-JTQLQIEISA-N |
| XLogP | 2.17 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|