C12H16BN5O5P+ — CID 90086114
CID 90086114 (PubChem CID 90086114) has the molecular formula C12H16BN5O5P+ and a molecular weight of 352.08 g/mol.
| Compound Name | CID 90086114 |
|---|---|
| PubChem CID | 90086114 |
| Molecular Formula | C12H16BN5O5P+ |
| Molecular Weight | 352.08 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | — |
| SMILES | [B][P+]1(O)OC[C@H]2O[C@@H](n3cnc4c(N(C)C)ncnc43)C(O)[C@H]2O1 |
| InChI | InChI=1S/C12H16BN5O5P/c1-17(2)10-7-11(15-4-14-10)18(5-16-7)12-8(19)9-6(22-12)3-21-24(13,20)23-9/h4-6,8-9,12,19-20H,3H2,1-2H3/q+1/t6-,8?,9+,12-,24?/m1/s1 |
| InChIKey | NPHHUCARSICYGF-BLIFPULZSA-N |
| XLogP | -0.60 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.08 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|