C10H12BN5O6P+ — CID 90086185
CID 90086185 (PubChem CID 90086185) has the molecular formula C10H12BN5O6P+ and a molecular weight of 340.02 g/mol.
| Compound Name | CID 90086185 |
|---|---|
| PubChem CID | 90086185 |
| Molecular Formula | C10H12BN5O6P+ |
| Molecular Weight | 340.02 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | — |
| SMILES | [H]/N=c1/c2ncn([C@@H]3O[C@@H]4CO[P+]([B])(O)O[C@@H]4C3O)c2ncn1O |
| InChI | InChI=1S/C10H12BN5O6P/c11-23(19)20-1-4-7(22-23)6(17)10(21-4)15-2-13-5-8(12)16(18)3-14-9(5)15/h2-4,6-7,10,12,17-19H,1H2/q+1/b12-8-/t4-,6?,7+,10-,23?/m1/s1 |
| InChIKey | OESOJRJIAJFGQJ-PQTQYYMYSA-N |
| XLogP | -1.54 |
| TPSA | 147.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.02 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|