C10H13N5O5 — CID 170990893
(2R,3R,4S,5R)-2-(1-hydroxy-6-iminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 170990893) has the molecular formula C10H13N5O5 and a molecular weight of 284.24 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(1-hydroxy-6-iminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(1-hydroxy-6-iminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 170990893 |
| Molecular Formula | C10H13N5O5 |
| Molecular Weight | 284.24 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | (2R,3R,4S,5R)-2-(1-hydroxy-6-iminopurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | [H]/N=c1/c2nc[15n]([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c2ncn1O |
| InChI | InChI=1S/C10H13N5O5/c11-8-5-9(13-3-15(8)19)14(2-12-5)10-7(18)6(17)4(1-16)20-10/h2-4,6-7,10-11,16-19H,1H2/b11-8-/t4-,6-,7-,10-/m1/s1/i14+1 |
| InChIKey | QHFLZHVITNUFMV-UYBDCJBFSA-N |
| XLogP | -2.44 |
| TPSA | 149.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.24 |
| LogP ≤ 5 | -2.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|