C11H15N5O5 — CID 5274365
(2R,3R,4S,5R)-2-(1-hydroxy-6-imino-2-methylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 5274365) has the molecular formula C11H15N5O5 and a molecular weight of 297.27 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(1-hydroxy-6-imino-2-methylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(1-hydroxy-6-imino-2-methylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 5274365 |
| Molecular Formula | C11H15N5O5 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | (2R,3R,4S,5R)-2-(1-hydroxy-6-imino-2-methylpurin-9-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | [H]/N=c1/c2ncn([C@@H]3O[C@H](CO)[C@@H](O)[C@H]3O)c2nc(C)n1O |
| InChI | InChI=1S/C11H15N5O5/c1-4-14-10-6(9(12)16(4)20)13-3-15(10)11-8(19)7(18)5(2-17)21-11/h3,5,7-8,11-12,17-20H,2H2,1H3/b12-9-/t5-,7-,8-,11-/m1/s1 |
| InChIKey | QASGPWZLUBEVAE-JOLDIKRXSA-N |
| XLogP | -2.13 |
| TPSA | 149.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | -2.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|