C11H13BN4O6P+ — CID 90086112
CID 90086112 (PubChem CID 90086112) has the molecular formula C11H13BN4O6P+ and a molecular weight of 339.03 g/mol.
| Compound Name | CID 90086112 |
|---|---|
| PubChem CID | 90086112 |
| Molecular Formula | C11H13BN4O6P+ |
| Molecular Weight | 339.03 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | — |
| SMILES | [B][P+]1(O)OC[C@H]2O[C@@H](n3cnc4c(OC)ncnc43)C(O)[C@@H]2O1 |
| InChI | InChI=1S/C11H13BN4O6P/c1-19-10-6-9(13-3-14-10)16(4-15-6)11-7(17)8-5(21-11)2-20-23(12,18)22-8/h3-5,7-8,11,17-18H,2H2,1H3/q+1/t5-,7?,8-,11-,23?/m1/s1 |
| InChIKey | UDKUDCAALKDUSL-XLQPNTPOSA-N |
| XLogP | -0.65 |
| TPSA | 120.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.03 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|