C18H24BN5O7P+ — CID 90086092
CID 90086092 (PubChem CID 90086092) has the molecular formula C18H24BN5O7P+ and a molecular weight of 464.20 g/mol.
| Compound Name | CID 90086092 |
|---|---|
| PubChem CID | 90086092 |
| Molecular Formula | C18H24BN5O7P+ |
| Molecular Weight | 464.20 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | — |
| SMILES | [B][P+]1(O)OC[C@H]2O[C@@H](n3cnc4c(NC(=O)CCC)ncnc43)C(OC(=O)CCC)[C@H]2O1 |
| InChI | InChI=1S/C18H24BN5O7P/c1-3-5-11(25)23-16-13-17(21-8-20-16)24(9-22-13)18-15(30-12(26)6-4-2)14-10(29-18)7-28-32(19,27)31-14/h8-10,14-15,18,27H,3-7H2,1-2H3,(H,20,21,23,25)/q+1/t10-,14+,15?,18-,32?/m1/s1 |
| InChIKey | FNBMJKWBZMJKHO-XARQKZBBSA-N |
| XLogP | 1.43 |
| TPSA | 146.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.20 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|