C18H23N5NaO8P — CID 170843905
sodium N-[9-(7-butanoyloxy-2-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl)purin-6-yl]butanimidate (PubChem CID 170843905) has the molecular formula C18H23N5NaO8P and a molecular weight of 491.37 g/mol. Its IUPAC name is sodium N-[9-(7-butanoyloxy-2-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl)purin-6-yl]butanimidate.
| Compound Name | sodium N-[9-(7-butanoyloxy-2-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl)purin-6-yl]butanimidate |
|---|---|
| PubChem CID | 170843905 |
| Molecular Formula | C18H23N5NaO8P |
| Molecular Weight | 491.37 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | sodium N-[9-(7-butanoyloxy-2-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl)purin-6-yl]butanimidate |
| SMILES | CCCC(=O)OC1C2OP(=O)(O)OCC2OC1n1cnc2c(N=C([O-])CCC)ncnc21.[Na+] |
| InChI | InChI=1S/C18H24N5O8P.Na/c1-3-5-11(24)22-16-13-17(20-8-19-16)23(9-21-13)18-15(30-12(25)6-4-2)14-10(29-18)7-28-32(26,27)31-14;/h8-10,14-15,18H,3-7H2,1-2H3,(H,26,27)(H,19,20,22,24);/q;+1/p-1 |
| InChIKey | KRBZRVBLIUDQNG-UHFFFAOYSA-M |
| XLogP | -1.85 |
| TPSA | 170.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.37 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|