C18H24N5NaO8P — CID 123133966
CID 123133966 (PubChem CID 123133966) has the molecular formula C18H24N5NaO8P and a molecular weight of 492.38 g/mol.
| Compound Name | CID 123133966 |
|---|---|
| PubChem CID | 123133966 |
| Molecular Formula | C18H24N5NaO8P |
| Molecular Weight | 492.38 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | — |
| SMILES | CCCC(=O)Nc1ncnc2c1ncn2[C@@H]1O[C@@H]2COP(=O)(O)OC2[C@@H]1OC(=O)CCC.[Na] |
| InChI | InChI=1S/C18H24N5O8P.Na/c1-3-5-11(24)22-16-13-17(20-8-19-16)23(9-21-13)18-15(30-12(25)6-4-2)14-10(29-18)7-28-32(26,27)31-14;/h8-10,14-15,18H,3-7H2,1-2H3,(H,26,27)(H,19,20,22,24);/t10-,14?,15+,18-;/m1./s1 |
| InChIKey | WAOODRHZYQRSDS-LJJPSWMDSA-N |
| XLogP | 1.31 |
| TPSA | 163.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.38 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|