C22H27N10O9P — CID 138746854
7-(6-aminopurin-9-yl)-11-hydroxy-16-[6-(methylamino)purin-9-yl]-11-oxo-2,6,10,12,15-pentaoxa-11λ5-phosphatricyclo[12.3.0.05,9]heptadecane-8,17-diol (PubChem CID 138746854) has the molecular formula C22H27N10O9P and a molecular weight of 606.49 g/mol. Its IUPAC name is 7-(6-aminopurin-9-yl)-11-hydroxy-16-[6-(methylamino)purin-9-yl]-11-oxo-2,6,10,12,15-pentaoxa-11λ5-phosphatricyclo[12.3.0.05,9]heptadecane-8,17-diol.
| Compound Name | 7-(6-aminopurin-9-yl)-11-hydroxy-16-[6-(methylamino)purin-9-yl]-11-oxo-2,6,10,12,15-pentaoxa-11λ5-phosphatricyclo[12.3.0.05,9]heptadecane-8,17-diol |
|---|---|
| PubChem CID | 138746854 |
| Molecular Formula | C22H27N10O9P |
| Molecular Weight | 606.49 g/mol |
| Exact Mass | 606.17 |
| IUPAC Name | 7-(6-aminopurin-9-yl)-11-hydroxy-16-[6-(methylamino)purin-9-yl]-11-oxo-2,6,10,12,15-pentaoxa-11λ5-phosphatricyclo[12.3.0.05,9]heptadecane-8,17-diol |
| SMILES | CNc1ncnc2c1ncn2C1OC2COP(=O)(O)OC3C(CCOC2C1O)OC(n1cnc2c(N)ncnc21)C3O |
| InChI | InChI=1S/C22H27N10O9P/c1-24-18-12-20(28-6-26-18)32(8-30-12)21-13(33)15-10(40-21)4-38-42(35,36)41-16-9(2-3-37-15)39-22(14(16)34)31-7-29-11-17(23)25-5-27-19(11)31/h5-10,13-16,21-22,33-34H,2-4H2,1H3,(H,35,36)(H2,23,25,27)(H,24,26,28) |
| InChIKey | IQGFWLNVQCIIMV-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 249.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.49 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|