C21H26N10O13P2 — CID 155053129
9-[8-(6-aminopurin-9-yl)-3,9,12,18-tetrahydroxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-2-(methylamino)-1H-purin-6-one (PubChem CID 155053129) has the molecular formula C21H26N10O13P2 and a molecular weight of 688.44 g/mol. Its IUPAC name is 9-[8-(6-aminopurin-9-yl)-3,9,12,18-tetrahydroxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-2-(methylamino)-1H-purin-6-one.
| Compound Name | 9-[8-(6-aminopurin-9-yl)-3,9,12,18-tetrahydroxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-2-(methylamino)-1H-purin-6-one |
|---|---|
| PubChem CID | 155053129 |
| Molecular Formula | C21H26N10O13P2 |
| Molecular Weight | 688.44 g/mol |
| Exact Mass | 688.12 |
| IUPAC Name | 9-[8-(6-aminopurin-9-yl)-3,9,12,18-tetrahydroxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-2-(methylamino)-1H-purin-6-one |
| SMILES | CNc1nc2c(ncn2C2OC3COP(=O)(O)OC4C(COP(=O)(O)OC2C3O)OC(n2cnc3c(N)ncnc32)C4O)c(=O)[nH]1 |
| InChI | InChI=1S/C21H26N10O13P2/c1-23-21-28-17-10(18(34)29-21)27-6-31(17)20-14-11(32)7(41-20)2-39-45(35,36)43-13-8(3-40-46(37,38)44-14)42-19(12(13)33)30-5-26-9-15(22)24-4-25-16(9)30/h4-8,11-14,19-20,32-33H,2-3H2,1H3,(H,35,36)(H,37,38)(H2,22,24,25)(H2,23,28,29,34) |
| InChIKey | SLTGBMKBTRKORN-UHFFFAOYSA-N |
| XLogP | -1.88 |
| TPSA | 315.66 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.44 |
| LogP ≤ 5 | -1.88 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|