C20H23N10O13P2- — CID 147135121
2-amino-9-[16-(6-aminopurin-9-yl)-11,17,18-trihydroxy-3-oxido-3,11-dioxo-2,4,7,10,12,15-hexaoxa-3λ5,11λ5-diphosphatricyclo[12.2.1.16,9]octadecan-8-yl]-1H-purin-6-one (PubChem CID 147135121) has the molecular formula C20H23N10O13P2- and a molecular weight of 673.41 g/mol. Its IUPAC name is 2-amino-9-[16-(6-aminopurin-9-yl)-11,17,18-trihydroxy-3-oxido-3,11-dioxo-2,4,7,10,12,15-hexaoxa-3λ5,11λ5-diphosphatricyclo[12.2.1.16,9]octadecan-8-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[16-(6-aminopurin-9-yl)-11,17,18-trihydroxy-3-oxido-3,11-dioxo-2,4,7,10,12,15-hexaoxa-3λ5,11λ5-diphosphatricyclo[12.2.1.16,9]octadecan-8-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 147135121 |
| Molecular Formula | C20H23N10O13P2- |
| Molecular Weight | 673.41 g/mol |
| Exact Mass | 673.09 |
| IUPAC Name | 2-amino-9-[16-(6-aminopurin-9-yl)-11,17,18-trihydroxy-3-oxido-3,11-dioxo-2,4,7,10,12,15-hexaoxa-3λ5,11λ5-diphosphatricyclo[12.2.1.16,9]octadecan-8-yl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2C2OC3COP(=O)([O-])OC4C(O)C(COP(=O)(O)OC2C3O)OC4n2cnc3c(N)ncnc32)c(=O)[nH]1 |
| InChI | InChI=1S/C20H24N10O13P2/c21-14-8-15(24-3-23-14)29(4-25-8)18-12-10(31)6(40-18)1-38-45(36,37)43-13-11(32)7(2-39-44(34,35)42-12)41-19(13)30-5-26-9-16(30)27-20(22)28-17(9)33/h3-7,10-13,18-19,31-32H,1-2H2,(H,34,35)(H,36,37)(H2,21,23,24)(H3,22,27,28,33)/p-1 |
| InChIKey | BQZWXNITEWDGCM-UHFFFAOYSA-M |
| XLogP | -2.97 |
| TPSA | 332.48 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.41 |
| LogP ≤ 5 | -2.97 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|