C24H31N11O13P2 — CID 155052980
2-amino-9-[8-(6-aminopurin-9-yl)-9,12,18-trihydroxy-3-morpholin-4-yl-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one (PubChem CID 155052980) has the molecular formula C24H31N11O13P2 and a molecular weight of 743.52 g/mol. Its IUPAC name is 2-amino-9-[8-(6-aminopurin-9-yl)-9,12,18-trihydroxy-3-morpholin-4-yl-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[8-(6-aminopurin-9-yl)-9,12,18-trihydroxy-3-morpholin-4-yl-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 155052980 |
| Molecular Formula | C24H31N11O13P2 |
| Molecular Weight | 743.52 g/mol |
| Exact Mass | 743.16 |
| IUPAC Name | 2-amino-9-[8-(6-aminopurin-9-yl)-9,12,18-trihydroxy-3-morpholin-4-yl-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one |
| SMILES | Nc1nc2c(ncn2C2OC3COP(=O)(O)OC4C(COP(=O)(N5CCOCC5)OC2C3O)OC(n2cnc3c(N)ncnc32)C4O)c(=O)[nH]1 |
| InChI | InChI=1S/C24H31N11O13P2/c25-18-12-19(28-7-27-18)34(8-29-12)22-15(37)16-11(46-22)6-43-49(39,33-1-3-42-4-2-33)47-17-14(36)10(5-44-50(40,41)48-16)45-23(17)35-9-30-13-20(35)31-24(26)32-21(13)38/h7-11,14-17,22-23,36-37H,1-6H2,(H,40,41)(H2,25,27,28)(H3,26,31,32,38) |
| InChIKey | GTWMOORQETVGGV-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 321.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.52 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|