C22H28N10O13P2 — CID 155053101
2-amino-9-[8-(6-aminopurin-9-yl)-9-ethoxy-3,12,18-trihydroxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one (PubChem CID 155053101) has the molecular formula C22H28N10O13P2 and a molecular weight of 702.47 g/mol. Its IUPAC name is 2-amino-9-[8-(6-aminopurin-9-yl)-9-ethoxy-3,12,18-trihydroxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one.
| Compound Name | 2-amino-9-[8-(6-aminopurin-9-yl)-9-ethoxy-3,12,18-trihydroxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one |
|---|---|
| PubChem CID | 155053101 |
| Molecular Formula | C22H28N10O13P2 |
| Molecular Weight | 702.47 g/mol |
| Exact Mass | 702.13 |
| IUPAC Name | 2-amino-9-[8-(6-aminopurin-9-yl)-9-ethoxy-3,12,18-trihydroxy-3,12-dioxo-2,4,7,11,13,16-hexaoxa-3λ5,12λ5-diphosphatricyclo[13.2.1.06,10]octadecan-17-yl]-1H-purin-6-one |
| SMILES | CCOC1C2OP(=O)(O)OCC3OC(n4cnc5c(=O)[nH]c(N)nc54)C(OP(=O)(O)OCC2OC1n1cnc2c(N)ncnc21)C3O |
| InChI | InChI=1S/C22H28N10O13P2/c1-2-39-15-13-9(43-21(15)31-6-27-10-16(23)25-5-26-17(10)31)4-41-47(37,38)45-14-12(33)8(3-40-46(35,36)44-13)42-20(14)32-7-28-11-18(32)29-22(24)30-19(11)34/h5-9,12-15,20-21,33H,2-4H2,1H3,(H,35,36)(H,37,38)(H2,23,25,26)(H3,24,29,30,34) |
| InChIKey | ISTVWSLVIJPGIT-UHFFFAOYSA-N |
| XLogP | -1.30 |
| TPSA | 318.65 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 20 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.47 |
| LogP ≤ 5 | -1.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 20 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|