C24H27N6NaO12P — CID 137248951
CID 137248951 (PubChem CID 137248951) has the molecular formula C24H27N6NaO12P and a molecular weight of 645.47 g/mol.
| Compound Name | CID 137248951 |
|---|---|
| PubChem CID | 137248951 |
| Molecular Formula | C24H27N6NaO12P |
| Molecular Weight | 645.47 g/mol |
| Exact Mass | 645.13 |
| IUPAC Name | — |
| SMILES | COC(=O)C(Cc1ccc(O)cc1)NC(=O)CCC(=O)OC1C2OP(=O)(O)OCC2OC1n1cnc2c(=O)[nH]c(N)nc21.[Na] |
| InChI | InChI=1S/C24H27N6O12P.Na/c1-38-23(35)13(8-11-2-4-12(31)5-3-11)27-15(32)6-7-16(33)41-19-18-14(9-39-43(36,37)42-18)40-22(19)30-10-26-17-20(30)28-24(25)29-21(17)34;/h2-5,10,13-14,18-19,22,31H,6-9H2,1H3,(H,27,32)(H,36,37)(H3,25,28,29,34); |
| InChIKey | RNCICXBLRCYRMV-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 256.51 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.47 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|