C16H23N6O7P — CID 171378621
1-[9-[(4aR,6R,7R,7aS)-2,7-dihydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]purin-6-yl]-3-tert-butyl-1-methylurea (PubChem CID 171378621) has the molecular formula C16H23N6O7P and a molecular weight of 442.37 g/mol. Its IUPAC name is 1-[9-[(4aR,6R,7R,7aS)-2,7-dihydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]purin-6-yl]-3-tert-butyl-1-methylurea.
| Compound Name | 1-[9-[(4aR,6R,7R,7aS)-2,7-dihydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]purin-6-yl]-3-tert-butyl-1-methylurea |
|---|---|
| PubChem CID | 171378621 |
| Molecular Formula | C16H23N6O7P |
| Molecular Weight | 442.37 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | 1-[9-[(4aR,6R,7R,7aS)-2,7-dihydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-6-yl]purin-6-yl]-3-tert-butyl-1-methylurea |
| SMILES | CN(C(=O)NC(C)(C)C)c1ncnc2c1ncn2[C@@H]1O[C@@H]2COP(=O)(O)O[C@H]2[C@H]1O |
| InChI | InChI=1S/C16H23N6O7P/c1-16(2,3)20-15(24)21(4)12-9-13(18-6-17-12)22(7-19-9)14-10(23)11-8(28-14)5-27-30(25,26)29-11/h6-8,10-11,14,23H,5H2,1-4H3,(H,20,24)(H,25,26)/t8-,10-,11-,14-/m1/s1 |
| InChIKey | ITFFQLHIVOEICK-IDTAVKCVSA-N |
| XLogP | 0.54 |
| TPSA | 161.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.37 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|