C17H17N4O6PS — CID 3010373
(6R,7R)-6-(6-benzylsulfanylpurin-9-yl)-2-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol (PubChem CID 3010373) has the molecular formula C17H17N4O6PS and a molecular weight of 436.39 g/mol. Its IUPAC name is (6R,7R)-6-(6-benzylsulfanylpurin-9-yl)-2-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol.
| Compound Name | (6R,7R)-6-(6-benzylsulfanylpurin-9-yl)-2-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol |
|---|---|
| PubChem CID | 3010373 |
| Molecular Formula | C17H17N4O6PS |
| Molecular Weight | 436.39 g/mol |
| Exact Mass | 436.06 |
| IUPAC Name | (6R,7R)-6-(6-benzylsulfanylpurin-9-yl)-2-hydroxy-2-oxo-4a,6,7,7a-tetrahydro-4H-furo[3,2-d][1,3,2]dioxaphosphinin-7-ol |
| SMILES | O=P1(O)OCC2O[C@@H](n3cnc4c(SCc5ccccc5)ncnc43)[C@H](O)C2O1 |
| InChI | InChI=1S/C17H17N4O6PS/c22-13-14-11(6-25-28(23,24)27-14)26-17(13)21-9-20-12-15(21)18-8-19-16(12)29-7-10-4-2-1-3-5-10/h1-5,8-9,11,13-14,17,22H,6-7H2,(H,23,24)/t11?,13-,14?,17-/m1/s1 |
| InChIKey | FOZDVJOYCWZSGU-UBMISVEKSA-N |
| XLogP | 1.89 |
| TPSA | 128.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|